CAS 83594-38-1

(2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate

Description:

The chemical substance known as (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate, with the CAS number 83594-38-1, is characterized by its complex structure that includes a thiazole ring, an amino group, and a methoxyimino moiety. This compound typically exhibits properties associated with both thiazole derivatives and oxime functionalities, which may contribute to its potential biological activity. The presence of the formylamino group suggests reactivity that could be relevant in various chemical reactions, including those involving nucleophiles. Additionally, the methoxyimino group may enhance the compound's solubility and stability in certain solvents. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific stereochemistry indicated by the (2E) designation suggests a particular geometric configuration that may influence the compound's reactivity and interactions with biological targets. Overall, this substance represents a unique combination of functional groups that could be of interest in medicinal chemistry and related fields.

Formula: C₇H₆N₃O₄S

InChI: InChI=1/C7H7N3O4S/c1-14-10-5(6(12)13)4-2-15-7(9-4)8-3-11/h2-3H,1H3,(H,12,13)(H,8,9,11)/p-1/b10-5+

Synonyms:

• 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid
• 2-(2-Formylamino-1,3-thiazol-4-yl)-2-(methoxyimino)acetic acid
• 2-(Formylamino)-alpha-methoxyimino-4-thiazoleacetic acid
• (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoic acid

2-(2-formylamino-1,3-thiazol-4-yl)-2-(methoxyimino)acetic acid

CAS: 83594-38-1

2-(2-formylamino-1,3-thiazol-4-yl)-2-(methoxyimino)acetic acid

Purity: ≥95%

Molecular weight: 229.21g/mol

Ref: 54-OR28720