CAS 83598-13-4

1,4,5-Oxadiazepine, 4,5-diacetylhexahydro-

Description:

1,4,5-Oxadiazepine, 4,5-diacetylhexahydro- is a heterocyclic compound characterized by a seven-membered ring containing both nitrogen and oxygen atoms. The structure features an oxadiazepine core, which is a bicyclic system that includes two nitrogen atoms and one oxygen atom within the ring. The presence of acetyl groups at the 4 and 5 positions contributes to its chemical reactivity and potential biological activity. This compound is typically synthesized through specific organic reactions involving the appropriate precursors. It may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's unique structure may influence its pharmacological properties, including its ability to act as a ligand or modulator in various biochemical pathways. As with many heterocycles, the stability and reactivity of 1,4,5-oxadiazepine derivatives can vary significantly based on substituents and environmental conditions.

Formula: C₈H₁₄N₂O₃

InChI: InChI=1S/C8H14N2O3/c1-7(11)9-3-5-13-6-4-10(9)8(2)12/h3-6H2,1-2H3

InChI key: InChIKey=MFIYYJKGKXOPMY-UHFFFAOYSA-N

SMILES: C(C)(=O)N1N(C(C)=O)CCOCC1

Synonyms:

• 1,4,5-Oxadiazepine, 4,5-diacetylhexahydro-