CAS 836-31-7
:4,4,4-Trifluoro-3-oxo-N-phenylbutanamide
Description:
4,4,4-Trifluoro-3-oxo-N-phenylbutanamide, with the CAS number 836-31-7, is a chemical compound characterized by its unique trifluoromethyl group and amide functional group. This compound features a phenyl group attached to a butanamide backbone, which contributes to its potential applications in pharmaceuticals and agrochemicals. The presence of three fluorine atoms enhances its lipophilicity and metabolic stability, making it an interesting candidate for drug development. The carbonyl group (oxo) in the structure indicates that it can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the compound's molecular structure suggests that it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Overall, 4,4,4-Trifluoro-3-oxo-N-phenylbutanamide is notable for its fluorinated nature, which often imparts unique characteristics to organic molecules, influencing their reactivity and interactions in biological systems.
Formula:C10H8F3NO2
InChI:InChI=1S/C10H8F3NO2/c11-10(12,13)8(15)6-9(16)14-7-4-2-1-3-5-7/h1-5H,6H2,(H,14,16)
InChI key:InChIKey=QJYDWPJWCSDYAG-UHFFFAOYSA-N
SMILES:N(C(CC(C(F)(F)F)=O)=O)C1=CC=CC=C1
Synonyms:- Butanamide, 4,4,4-trifluoro-3-oxo-N-phenyl-
- Acetoacetanilide, 4,4,4-trifluoro-
- 4,4,4-Trifluoro-3-oxo-N-phenylbutanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
