CAS 83601-86-9
:1-{2-[(1-carboxy-3-phenylpropyl)amino]propanoyl}octahydro-1H-indole-2-carboxylic acid (non-preferred name)
Description:
The chemical substance known as 1-{2-[(1-carboxy-3-phenylpropyl)amino]propanoyl}octahydro-1H-indole-2-carboxylic acid, with the CAS number 83601-86-9, is a complex organic compound characterized by its multi-functional structure. It features an octahydroindole core, which contributes to its cyclic and saturated nature, providing stability and potential for various interactions. The presence of carboxylic acid groups indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for biological activity, possibly as a pharmaceutical agent. The phenylpropyl moiety adds hydrophobic characteristics, influencing its interaction with biological membranes. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would require careful consideration of stereochemistry and functional group reactivity to ensure the desired biological activity is achieved.
Formula:C22H30N2O5
InChI:InChI=1/C22H30N2O5/c1-14(23-17(21(26)27)12-11-15-7-3-2-4-8-15)20(25)24-18-10-6-5-9-16(18)13-19(24)22(28)29/h2-4,7-8,14,16-19,23H,5-6,9-13H2,1H3,(H,26,27)(H,28,29)
SMILES:CC(C(=O)N1C2CCCCC2CC1C(=O)O)NC(CCc1ccccc1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
