CAS 83609-87-4

4-hydroxy-7-methyl-3-phenyl-1,2-dihydroquinolin-2-one

Description:

4-Hydroxy-7-methyl-3-phenyl-1,2-dihydroquinolin-2-one, with the CAS number 83609-87-4, is a chemical compound that belongs to the class of quinolines, which are bicyclic aromatic compounds. This substance features a quinolinone structure, characterized by a fused benzene and pyridine ring system, with a hydroxyl group (-OH) and a methyl group (-CH3) at specific positions on the ring. The presence of the phenyl group contributes to its aromatic properties and may influence its reactivity and solubility. This compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial or anticancer properties. Its solubility can vary depending on the solvent used, and it may exhibit different physical properties like melting point and boiling point based on its molecular structure. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.

Formula: C₁₆H₁₃NO₂

InChI: InChI=1/C16H13NO2/c1-10-7-8-12-13(9-10)17-16(19)14(15(12)18)11-5-3-2-4-6-11/h2-9H,1H3,(H2,17,18,19)

SMILES: Cc1ccc2c(c1)nc(c(c1ccccc1)c2O)O

Synonyms:

• 2-hydroxy-7-methyl-3-phenylquinolin-4(1H)-one

4-Hydroxy-7-methyl-3-phenyl-1H-quinolin-2-one

CAS: 83609-87-4

4-Hydroxy-7-methyl-3-phenyl-1H-quinolin-2-one

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 251.28g/mol

Ref: 54-OR0532