CymitQuimica logo

CAS 83619-73-2

:

1,4-diacetoxy-2,3-dicyanobenzene

Description:
1,4-Diacetoxy-2,3-dicyanobenzene, with the CAS number 83619-73-2, is an organic compound characterized by its complex aromatic structure. It features two acetoxy groups (-OCOCH3) and two cyano groups (-CN) attached to a benzene ring, specifically at the 1,4 and 2,3 positions, respectively. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and pigments due to its conjugated system, which can absorb light effectively. The presence of cyano groups contributes to its electron-withdrawing properties, influencing its reactivity and stability. Additionally, the acetoxy groups can participate in various chemical reactions, making this compound versatile in synthetic chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C12H8N2O4
InChI:InChI=1/C12H8N2O4/c1-7(15)17-11-3-4-12(18-8(2)16)10(6-14)9(11)5-13/h3-4H,1-2H3
SMILES:CC(=O)Oc1ccc(c(C#N)c1C#N)OC(=O)C
Synonyms:
  • 2,3-Dicyano-1,4-Hydroquinone Diacetate
  • 3,6-Diacetoxyphthalonitrile
  • 2,3-Dicyanobenzene-1,4-Diyl Diacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.