CAS 83619-74-3

2-[Methyl[(4-nitrophenyl)methyl]amino]ethanol

Description:

2-[Methyl[(4-nitrophenyl)methyl]amino]ethanol, with the CAS number 83619-74-3, is an organic compound characterized by its amine and alcohol functional groups. This substance features a methyl group attached to a nitrogen atom, which is further connected to a 4-nitrophenylmethyl group, indicating the presence of a nitro substituent on the aromatic ring. The compound's structure suggests it may exhibit both hydrophilic and lipophilic properties due to the presence of the hydroxyl (-OH) group and the aromatic system, respectively. This dual nature can influence its solubility in various solvents and its potential interactions in biological systems. The nitro group may also impart specific reactivity, making it a candidate for various chemical reactions or applications in pharmaceuticals or materials science. Additionally, the compound's molecular weight, melting point, and boiling point would be relevant for practical applications, although these specific values are not provided here. Overall, its unique structure positions it as a compound of interest in synthetic organic chemistry and potential medicinal chemistry applications.

Formula: C₁₀H₁₄N₂O₃

InChI: InChI=1S/C10H14N2O3/c1-11(6-7-13)8-9-2-4-10(5-3-9)12(14)15/h2-5,13H,6-8H2,1H3

InChI key: InChIKey=WHPGFIPBWHDGGE-UHFFFAOYSA-N

SMILES: C(N(CCO)C)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• N-Methyl-N-(2-hydroxyethyl)-p-nitrobenzylamine
• Ethanol, 2-[methyl[(4-nitrophenyl)methyl]amino]-
• 2-[Methyl[(4-nitrophenyl)methyl]amino]ethanol
• 2-[Methyl-(4-nitro-benzyl)-amino]-ethanol
• 2-[Methyl[(4-nitrophenyl)methyl]amino]ethan-1-ol