CymitQuimica logo

CAS 83621-01-6

:

6-Methoxypyridine-2-carbonitrile

Description:
6-Methoxypyridine-2-carbonitrile, with the CAS number 83621-01-6, is an organic compound characterized by its pyridine ring structure substituted with a methoxy group and a cyano group. The methoxy group (-OCH3) is attached to the sixth position of the pyridine ring, while the cyano group (-C≡N) is located at the second position. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its aromatic properties. It is soluble in polar organic solvents, which makes it useful in various chemical reactions and applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of both the methoxy and cyano groups contributes to its reactivity, allowing for further functionalization. Additionally, 6-Methoxypyridine-2-carbonitrile may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C7H6N2O
InChI:InChI=1/C7H6N2O/c1-10-7-4-2-3-6(5-8)9-7/h2-4H,1H3
InChI key:LTSUUWWSGRKYFO-UHFFFAOYSA-N
SMILES:COc1cccc(C#N)n1
Synonyms:
  • 2-Pyridinecarbonitrile, 6-Methoxy-
  • 6-Methoxypicolinonitrile
Found 4 products.