CAS 83621-33-4

N-Cbz-hexahydro-1H-azepin-4-one

Description:

N-Cbz-hexahydro-1H-azepin-4-one, with the CAS number 83621-33-4, is a chemical compound characterized by its unique structure, which includes a hexahydroazepine ring and a carbobenzyloxy (Cbz) protecting group. This compound typically exhibits properties associated with cyclic amines, such as moderate polarity and the ability to participate in hydrogen bonding due to the presence of the nitrogen atom in the ring. The Cbz group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications, particularly in peptide synthesis and medicinal chemistry. The azepine ring contributes to its potential biological activity, as cyclic amines are often found in pharmacologically active compounds. Additionally, N-Cbz-hexahydro-1H-azepin-4-one can undergo various chemical transformations, allowing for further functionalization and derivatization in organic synthesis. Overall, this compound serves as a valuable intermediate in the development of more complex molecules in pharmaceutical research.

Formula: C₁₄H₁₇NO₃

InChI: InChI=1/C14H17NO3/c16-13-7-4-9-15(10-8-13)14(17)18-11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2

SMILES: c1ccc(cc1)COC(=O)N1CCCC(=O)CC1

Synonyms:

• N-CBZ-perhydroazepin-4-one
• Benzyl 4-Oxoazepane-1-Carboxylate

Benzyl 4-oxoazepane-1-carboxylate

CAS: 83621-33-4

Formula: C₁₄H₁₇NO₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 247.2897

Ref: IN-DA004YVH

Azepan-4-one, N-CBZ protected

CAS: 83621-33-4

Azepan-4-one, N-CBZ protected

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 247.29g/mol

Ref: 54-OR4404

Benzyl 4-oxoazepane-1-carboxylate

CAS: 83621-33-4

Formula: C₁₄H₁₇NO₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 247.294

Ref: 10-F078144