CAS 83635-12-5
:butyl cyclopropanesulfonate
Description:
Butyl cyclopropanesulfonate, with the CAS number 83635-12-5, is an organic compound characterized by its sulfonate functional group attached to a cyclopropane ring, which is further substituted with a butyl group. This compound typically exhibits properties associated with sulfonates, such as high solubility in polar solvents and potential reactivity in nucleophilic substitution reactions. The cyclopropane moiety contributes to its unique structural rigidity, which can influence its chemical reactivity and interactions with other molecules. Butyl cyclopropanesulfonate may be utilized in various applications, including as a reagent in organic synthesis or as an intermediate in the production of more complex chemical entities. Its physical properties, such as boiling point, melting point, and density, would depend on the specific structural configuration and purity of the compound. Safety data should be consulted to understand its handling and potential hazards, as sulfonates can vary in toxicity and environmental impact. Overall, butyl cyclopropanesulfonate represents a versatile compound within the realm of organic chemistry.
Formula:C7H14O3S
InChI:InChI=1/C7H14O3S/c1-2-3-6-10-11(8,9)7-4-5-7/h7H,2-6H2,1H3
SMILES:CCCCOS(=O)(=O)C1CC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Butyl cyclopropanesulfonate
CAS:Formula:C7H14O3SPurity:98%Color and Shape:LiquidMolecular weight:178.2493Butyl cyclopropanesulfonate
CAS:Butyl cyclopropanesulfonate is a molecule that has been shown to be effective in treating cancer. It binds to the amino acid tropomyosin, which is found in the cell membrane of cancer cells and inhibits the flow of calcium ions through the cell membrane. This leads to disruption of calcium-dependent processes such as protein synthesis and cellular division. The binding site on tropomyosin for butyl cyclopropanesulfonate has been determined using a vitro method. Butyl cyclopropanesulfonate also inhibits fatty acid synthesis, which may be beneficial for patients with inflammatory diseases or hyperproliferative diseases.Formula:C7H14O3SPurity:Min. 95%Color and Shape:Clear Colourless LiquidMolecular weight:178.25 g/mol



