CAS 83649-47-2
:(S)-3-amino-3-phenylpropionic acid hydrochloride
Description:
(S)-3-amino-3-phenylpropionic acid hydrochloride, with the CAS number 83649-47-2, is a chiral amino acid derivative characterized by its specific stereochemistry, which is denoted by the (S) configuration. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and a phenyl group attached to a propionic acid backbone. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in biochemical and pharmaceutical contexts. The presence of the phenyl group contributes to its hydrophobic characteristics, while the amino and carboxylic acid groups impart polar properties, allowing for potential interactions in biological systems. This compound may serve as a building block in peptide synthesis or as a chiral auxiliary in asymmetric synthesis. Additionally, its biological activity may be explored in the context of neurotransmitter function or as a potential therapeutic agent, although specific applications would depend on further research and development.
Formula:C9H12ClNO2
InChI:InChI=1/C9H11NO2.ClH/c10-8(6-9(11)12)7-4-2-1-3-5-7;/h1-5,8H,6,10H2,(H,11,12);1H/t8-;/m0./s1
SMILES:c1ccc(cc1)[C@H](CC(=O)O)N.Cl
Synonyms:- L-(+)-3-amino-3-phenylpropionic acid hydrochloride
- D-Beta-Homophenylglycine Hydrochloride
- H-D-Phg-(C*Ch2)Oh Hcl
- (S)-3-Amino-3-Phenylpropanoic Acid Hydrochloride
- (S)-(+)-3-Amino-3-Phenylpropionic Acid Hcl
- Rarechem Ak Pt 0078
- L-Beta-Phenylalanine Hcl
- (S)-3-Amino-3-phenylpropanoic Acid Hydrochloride S
- Benzenepropanoic acid, β-amino-, (betaS)-, hydrochloride (1:1)
- S-3-Amino-3-phenyl-propionic acid hydrochloride
- (s)-(+)-3-amino-3-phenylpropionic acid hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-(-)-3-Amino-3-phenylpropionic acid, HCl
CAS:Formula:C9H12ClNO2Purity:97%Color and Shape:SolidMolecular weight:201.6501(S)-(-)-3-Amino-3-phenylpropionic acid hydrochloride
CAS:Formula:C9H12ClNO2Purity:95.0%Color and Shape:SolidMolecular weight:201.65(S)-3-Phenyl-β-alanine Hydrochloride
CAS:Controlled ProductFormula:C9H11NO2·ClHColor and Shape:NeatMolecular weight:201.65



