CAS 83657-16-3
:(R)-Uniconazole
Description:
(R)-Uniconazole is a chemical compound classified as a plant growth regulator, primarily used to inhibit gibberellin biosynthesis, which in turn affects plant growth and development. It is a chiral molecule, with the (R) configuration indicating its specific stereochemistry, which is crucial for its biological activity. The compound is typically utilized in agricultural practices to promote compact growth in various crops, enhance flowering, and improve fruit quality. Its mode of action involves the suppression of stem elongation, making it particularly valuable in ornamental horticulture. In terms of physical properties, (R)-Uniconazole is generally characterized by its solubility in organic solvents and limited solubility in water. Safety and environmental considerations are important, as with any chemical used in agriculture, necessitating adherence to regulatory guidelines for application and handling. Overall, (R)-Uniconazole serves as an effective tool for managing plant growth, contributing to improved agricultural productivity and aesthetic quality in horticultural applications.
Formula:C15H18ClN3O
InChI:InChI=1S/C15H18ClN3O/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11/h4-10,14,20H,1-3H3/b13-8+/t14-/m0/s1
InChI key:InChIKey=YNWVFADWVLCOPU-CZAWJFPGSA-N
SMILES:C(=C\C1=CC=C(Cl)C=C1)(\[C@@H](C(C)(C)C)O)/N2C=NC=N2
Synonyms:- (R)-S 3307
- (R)-Uniconazole
- (R)-UNICONAZOLE
- 1H-1,2,4-Triazole-1-ethanol, β-[(4-chlorophenyl)methylene]-α-(1,1-dimethylethyl)-, [R-(E)]-
- 1H-1,2,4-Triazole-1-ethanol, β-[(4-chlorophenyl)methylene]-α-(1,1-dimethylethyl)-, (αR,βE)-
- (αR,βE)-β-[(4-Chlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

