CymitQuimica logo

CAS 83665-76-3

:

(2E)-3-(3,4-Dichlorophenyl)-2-propen-1-amine

Description:
(2E)-3-(3,4-Dichlorophenyl)-2-propen-1-amine, also known as a substituted propenamine, is characterized by its structural features, including a propenamine backbone with a dichlorophenyl substituent. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the dichlorophenyl group can influence its lipophilicity and reactivity, potentially enhancing its biological activity. It may also exhibit specific optical isomerism due to the presence of a double bond in the propenamine structure. This compound is often studied in the context of medicinal chemistry, where its derivatives may show potential therapeutic effects. Additionally, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, this compound's unique structure contributes to its potential applications in various chemical and pharmaceutical contexts.
Formula:C9H9Cl2N
InChI:InChI=1S/C9H9Cl2N/c10-8-4-3-7(2-1-5-12)6-9(8)11/h1-4,6H,5,12H2/b2-1+
InChI key:InChIKey=SVLYGNKFNCGGSH-OWOJBTEDSA-N
SMILES:C(=C/CN)\C1=CC(Cl)=C(Cl)C=C1
Synonyms:
  • (2E)-3-(3,4-Dichlorophenyl)-2-propen-1-amine
  • 2-Propen-1-amine, 3-(3,4-dichlorophenyl)-, (2E)-
  • 2-Propen-1-amine, 3-(3,4-dichlorophenyl)-, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.