CymitQuimica logo

CAS 83665-88-7

:

2-Propen-1-amine, 3-(5-pyrimidinyl)-, (E)-

Description:
2-Propen-1-amine, 3-(5-pyrimidinyl)-, (E)-, also known by its CAS number 83665-88-7, is an organic compound characterized by its structure, which features a propenamine backbone with a pyrimidine ring substituent. This compound is classified as an amine and is notable for its unsaturated double bond, which contributes to its reactivity. The presence of the pyrimidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often found in biologically active compounds. The (E)- configuration indicates that the substituents around the double bond are arranged in a trans orientation, which can influence the compound's physical and chemical properties, such as solubility and reactivity. Additionally, this compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. Overall, 2-Propen-1-amine, 3-(5-pyrimidinyl)-, (E)- is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c8-3-1-2-7-4-9-6-10-5-7/h1-2,4-6H,3,8H2/b2-1+
InChI key:InChIKey=WFTKGOSJJIRZEX-OWOJBTEDSA-N
SMILES:C(=C/CN)\C=1C=NC=NC1
Synonyms:
  • 2-Propen-1-amine, 3-(5-pyrimidinyl)-, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.