CAS 83670-46-6

O-[(3-Bromophenyl)methyl]hydroxylamine

Description:

O-[(3-Bromophenyl)methyl]hydroxylamine is an organic compound characterized by the presence of a hydroxylamine functional group (-NH2OH) attached to a benzyl group that features a bromine substituent on the aromatic ring. This compound typically exhibits properties associated with both hydroxylamines and aromatic bromides, including potential reactivity in nucleophilic substitution reactions due to the presence of the bromine atom. The hydroxylamine group can participate in various chemical transformations, such as oxidation and condensation reactions, making it useful in synthetic organic chemistry. Additionally, the presence of the bromine atom can influence the compound's solubility and reactivity, often enhancing its electrophilic character. O-[(3-Bromophenyl)methyl]hydroxylamine may also exhibit biological activity, as many hydroxylamines are known to interact with biological systems. Safety considerations should be taken into account when handling this compound, as hydroxylamines can be sensitive to oxidation and may pose health risks. Overall, this compound serves as a valuable intermediate in chemical synthesis and research applications.

Formula: C₇H₈BrNO

InChI: InChI=1S/C7H8BrNO/c8-7-3-1-2-6(4-7)5-10-9/h1-4H,5,9H2

InChI key: InChIKey=FDOCPMYZVHLPNE-UHFFFAOYSA-N

SMILES: C(ON)C1=CC(Br)=CC=C1

Synonyms:

• O-(m-Bromobenzyl)hydroxylamine
• Hydroxylamine, O-[(3-bromophenyl)methyl]-
• O-[(3-Bromophenyl)methyl]hydroxylamine