CymitQuimica logo

CAS 83670-50-2

:

3-Bromo-N-hydroxybenzenemethanamine

Description:
3-Bromo-N-hydroxybenzenemethanamine, with the CAS number 83670-50-2, is an organic compound characterized by the presence of a bromine atom, a hydroxyl group, and an amine functional group attached to a benzene ring. This compound features a bromine substituent at the meta position relative to the amine group, which influences its reactivity and solubility. The hydroxyl group contributes to its potential as a hydrogen bond donor and affects its polarity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of both the amine and hydroxyl groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the bromine atom can serve as a leaving group in certain reactions, enhancing its synthetic utility. Overall, 3-Bromo-N-hydroxybenzenemethanamine is a versatile compound with potential applications in organic synthesis and drug development.
Formula:C7H8BrNO
InChI:InChI=1S/C7H8BrNO/c8-7-3-1-2-6(4-7)5-9-10/h1-4,9-10H,5H2
InChI key:InChIKey=WPKDRHQWUZRLGF-UHFFFAOYSA-N
SMILES:C(NO)C1=CC(Br)=CC=C1
Synonyms:
  • Benzenemethanamine, 3-bromo-N-hydroxy-
  • 3-Bromo-N-hydroxybenzenemethanamine
  • N-(m-Bromobenzyl)hydroxylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.