CAS 83680-34-6

(3S)-3-(tetrahydro-2H-pyran-2-yloxy)dihydrofuran-2(3H)-one

Description:

The chemical substance known as (3S)-3-(tetrahydro-2H-pyran-2-yloxy)dihydrofuran-2(3H)-one, with the CAS number 83680-34-6, is characterized by its unique structural features that include a dihydrofuran ring and a tetrahydropyran moiety. This compound is classified as a lactone, which is a cyclic ester formed from the reaction of an alcohol and a carboxylic acid. The presence of the tetrahydro-2H-pyran group contributes to its potential solubility in organic solvents and may influence its reactivity and interaction with biological systems. The stereochemistry at the 3-position, indicated by the (3S) designation, suggests specific spatial arrangements that can affect the compound's biological activity and properties. Such compounds may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. Additionally, the presence of oxygen atoms in the structure indicates potential for hydrogen bonding, which can further influence its physical and chemical properties, such as boiling point, melting point, and reactivity with other chemical species.

Formula: C₉H₁₄O₄

InChI: InChI=1/C9H14O4/c10-9-7(4-6-12-9)13-8-3-1-2-5-11-8/h7-8H,1-6H2/t7-,8?/m0/s1

SMILES: C1CCOC(C1)O[C@H]1CCOC1=O