CAS 83683-82-3

4-nitro-1H-pyrrolo[2,3-b]pyridine

Description:

4-Nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, with a nitro group (-NO2) attached to the pyrrole moiety. This compound typically exhibits a pale yellow to brownish appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the nitro group can influence its reactivity and interactions with biological targets. Additionally, 4-nitro-1H-pyrrolo[2,3-b]pyridine may exhibit properties such as fluorescence or photostability, depending on the specific conditions. As with many nitro-containing compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Its applications may extend to areas such as agrochemicals, pharmaceuticals, and materials science, where its unique structural features can be leveraged for various chemical reactions and synthesis pathways.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-10(12)6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H,8,9)

SMILES: c1cnc2c1c(cc[nH]2)N(=O)=O

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine, 4-nitro-
• 4-Nitro-1H-pyrrolo[2,3-b]pyridin
• 4-Nitro-7-azaindole

4-Nitro-7-azaindole

CAS: 83683-82-3

Formula: C₇H₅N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA004Y1M

4-Nitro-1H-pyrrolo[2,3-b]pyridine

CAS: 83683-82-3

4-Nitro-1H-pyrrolo[2,3-b]pyridine

Purity: 95%

Molecular weight: 163.13g/mol

Ref: 54-OR301264

4-Nitro-7-azaindole

CAS: 83683-82-3

Formula: C₇H₅N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.136

Ref: 10-F079773