CAS 83690-82-8

(2R,4R)-2-[(1R)-1-phenylethyl]-1,3-thiazolidin-3-ium-4-carboxylate

Description:

The chemical substance known as (2R,4R)-2-[(1R)-1-phenylethyl]-1,3-thiazolidin-3-ium-4-carboxylate, with the CAS number 83690-82-8, is a thiazolidin derivative characterized by its unique structural features. It contains a thiazolidine ring, which is a five-membered heterocyclic compound featuring sulfur and nitrogen atoms. The presence of a carboxylate group indicates that it has acidic properties, making it potentially useful in various chemical reactions. The stereochemistry, denoted by the (2R,4R) and (1R) designations, suggests that the molecule has specific spatial arrangements that can influence its biological activity and reactivity. This compound may exhibit chiral properties, which can be significant in pharmaceutical applications, particularly in drug design and synthesis. Additionally, the phenylethyl group contributes to its hydrophobic characteristics, potentially affecting its solubility and interaction with biological membranes. Overall, this compound's unique structure and functional groups suggest a range of potential applications in medicinal chemistry and organic synthesis.

Formula: C₁₂H₁₅NO₂S

InChI: InChI=1/C12H15NO2S/c1-8(9-5-3-2-4-6-9)11-13-10(7-16-11)12(14)15/h2-6,8,10-11,13H,7H2,1H3,(H,14,15)/t8-,10+,11-/m1/s1