CAS 83690-98-6

1,3,6,9-tetrachlorodibenzo[b,d]furan

Description:

1,3,6,9-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with four chlorine atoms substituted at specific positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. It typically appears as a solid at room temperature and is insoluble in water, but may dissolve in organic solvents. The presence of chlorine atoms significantly influences its chemical properties, including its reactivity and stability. 1,3,6,9-Tetrachlorodibenzo[b,d]furan is of interest in environmental chemistry due to its potential as a pollutant and its implications for human health and ecosystems. Its synthesis and degradation pathways are important for understanding its environmental impact, as well as its behavior in biological systems. Safety precautions are necessary when handling this compound, given its potential hazardous effects.

Formula: C₁₂H₄Cl₄O

InChI: InChI=1/C12H4Cl4O/c13-5-3-8(16)10-9(4-5)17-12-7(15)2-1-6(14)11(10)12/h1-4H

SMILES: c1cc(c2c(c1Cl)c1c(cc(cc1o2)Cl)Cl)Cl

Synonyms:

• 1,3,6,9-Tetrachlorodibenzofuran
• Dibenzofuran, 1,3,6,9-tetrachloro