
CAS 83692-05-1
:(1S,4aR,4bS,7S,10aR)-7-Ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-1-phenanthrenemethanol
Description:
The chemical substance with the name "(1S,4aR,4bS,7S,10aR)-7-Ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-1-phenanthrenemethanol" and CAS number "83692-05-1" is a complex organic compound characterized by its multi-ring structure, which includes a phenanthrene core. This compound features multiple stereocenters, indicating that it exists in specific stereoisomeric forms, which can significantly influence its chemical behavior and biological activity. The presence of an ethenyl group suggests potential reactivity, particularly in polymerization or addition reactions. Additionally, the hydroxyl (-OH) functional group indicates that it may exhibit alcohol-like properties, such as hydrogen bonding, which can affect its solubility and interaction with other molecules. The compound's intricate structure and stereochemistry may contribute to its potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C20H32O
InChI:InChI=1S/C20H32O/c1-5-18(2)12-9-16-15(13-18)7-8-17-19(3,14-21)10-6-11-20(16,17)4/h5,7,16-17,21H,1,6,8-14H2,2-4H3/t16-,17-,18-,19+,20+/m0/s1
InChI key:InChIKey=DUEINKIQNGZKPL-WKWVNEEDSA-N
SMILES:C[C@@]12[C@@]3(C(=CC[C@]1([C@](CO)(C)CCC2)[H])C[C@](C=C)(C)CC3)[H]
Synonyms:- (1S,4aR,4bS,7S,10aR)-7-Ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-1-phenanthrenemethanol
- 1-Phenanthrenemethanol, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, (1S,4aR,4bS,7S,10aR)-
- 1-Phenanthrenemethanol, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydro-1,4a,7-trimethyl-, [1S-(1α,4aα,4bβ,7β,10aβ)]-
- Akhdarenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Akhdarenol
CAS:Akhdarenol is a biochemical.Formula:C20H32OColor and Shape:SolidMolecular weight:288.47
