CAS 83692-82-4

6-methyl-2-nitroimidazo[1,2-a:5,4-b']dipyridine

Description:

6-Methyl-2-nitroimidazo[1,2-a:5,4-b']dipyridine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both imidazole and pyridine rings. This compound features a methyl group and a nitro group, contributing to its unique chemical properties and reactivity. The presence of the nitro group typically enhances the compound's electron-withdrawing characteristics, which can influence its behavior in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the imidazo and pyridine moieties may impart biological activity, making such compounds of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Its molecular structure allows for potential interactions with biological targets, which is often explored in drug design and development. Overall, 6-methyl-2-nitroimidazo[1,2-a:5,4-b']dipyridine represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₈N₄O₂

InChI: InChI=1/C11H8N4O2/c1-7-3-2-6-14-10(7)12-8-4-5-9(15(16)17)13-11(8)14/h2-6H,1H3

SMILES: Cc1cccn2c1nc1ccc(nc21)N(=O)=O

2-Nitro-6-methyldipyrido[1,2-a:3',2'-d]imidazole

Controlled Product

CAS: 83692-82-4

Applications A highly mutagenic metabolite of 2-Amino-6-methyldipyrido[1,2-a:3',2'-d]imidazole (A616100).
References Layton, D., et al.: Carcinogenesis, 16, 39 (1995), Arvidsson, P., et al.: J. Food Sci., 64, 216 (1999), Weisburger, J., et al.: Mutat. Res. 516, 19 (2002),

Formula: C₁₁H₈N₄O₂

Color and Shape: Neat

Molecular weight: 228.207

Ref: TR-N496615