CAS 83702-52-7

6-acetyl-7-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile

Description:

6-Acetyl-7-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features an acetyl group at the 6-position and a methyl group at the 7-position of the pyrazolo ring, contributing to its chemical reactivity and potential biological activity. The presence of a carbonitrile group at the 3-position enhances its polarity and may influence its solubility in various solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many heterocycles, the electronic properties and steric factors of the substituents play a crucial role in determining its reactivity and interactions with biological targets.

Formula: C₁₀H₈N₄O

InChI: InChI=1/C10H8N4O/c1-6-9(7(2)15)5-12-10-8(3-11)4-13-14(6)10/h4-5H,1-2H3

Synonyms:

• pyrazolo[1,5-a]pyrimidine-3-carbonitrile, 6-acetyl-7-methyl-
• 6-Acetyl-7-methyl-pyrazolo[1,5-a]pyrimidine-3-carbonitrile
• 6-Acetyl-7-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile

6-Acetyl-7-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile

CAS: 83702-52-7

Formula: C₁₀H₈N₄O

Color and Shape: Solid

Molecular weight: 200.1967

Ref: IN-DA0056BO