CAS 83704-21-6
:1,2,3,6-tetrachlorodibenzo[b,d]furan
Description:
1,2,3,6-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with four chlorine atoms substituted at specific positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. It typically appears as a solid at room temperature and is insoluble in water but may dissolve in organic solvents. The presence of chlorine atoms significantly influences its chemical properties, including its reactivity and stability. 1,2,3,6-Tetrachlorodibenzo[b,d]furan is of interest in environmental chemistry due to its potential formation during the combustion of chlorinated organic materials and its implications for human health and ecological systems. Its toxicological profile suggests that it may exhibit harmful effects, including carcinogenicity, necessitating careful handling and regulation. Overall, this compound exemplifies the complexities associated with chlorinated aromatic compounds in both industrial applications and environmental contexts.
Formula:C12H4Cl4O
InChI:InChI=1/C12H4Cl4O/c13-6-3-1-2-5-9-8(17-12(5)6)4-7(14)10(15)11(9)16/h1-4H
SMILES:c1cc2c3c(cc(c(c3Cl)Cl)Cl)oc2c(c1)Cl
Synonyms:- Dibenzofuran, 1,2,3,6-tetrachloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.