CAS 83704-25-0
:1,2,6,7-tetrachlorodibenzo[b,d]furan
Description:
1,2,6,7-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound belonging to the class of chlorinated dibenzofurans, which are polycyclic aromatic compounds. This substance is characterized by its structure, which consists of two fused benzene rings and a furan ring, with four chlorine atoms substituted at specific positions on the aromatic system. It is typically a white to light yellow solid and is known for its stability and resistance to degradation. The compound is of interest due to its potential environmental persistence and toxicity, particularly as a pollutant resulting from industrial processes or combustion of chlorinated materials. Its chemical properties include a relatively high melting point and low solubility in water, which can influence its behavior in environmental contexts. Additionally, 1,2,6,7-tetrachlorodibenzo[b,d]furan may exhibit bioaccumulation potential, raising concerns regarding its impact on human health and ecosystems. As with many chlorinated compounds, it is subject to regulatory scrutiny due to its potential carcinogenicity and environmental hazards.
Formula:C12H4Cl4O
InChI:InChI=1/C12H4Cl4O/c13-6-3-4-8-9(10(6)15)5-1-2-7(14)11(16)12(5)17-8/h1-4H
Synonyms:- dibenzofuran, 1,2,6,7-tetrachloro-
- 1,2,6,7-TETRACHLORODIBENZOFURAN
- Dibenzofuran, 1,2,6,7-tetrachloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.