CAS 83704-28-3

1,3,4,9-tetrachlorodibenzo[b,d]furan

Description:

1,3,4,9-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with four chlorine atoms substituted at specific positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. It typically appears as a solid at room temperature and is insoluble in water, but may dissolve in organic solvents. The presence of chlorine atoms significantly influences its chemical properties, including its reactivity and stability. 1,3,4,9-Tetrachlorodibenzo[b,d]furan is of interest in environmental chemistry due to its potential as a pollutant and its implications for human health and ecosystems. Studies have indicated that compounds in this class can exhibit harmful effects, including carcinogenicity and endocrine disruption. As such, understanding its behavior in the environment and its toxicological profile is crucial for assessing risks associated with exposure.

Formula: C₁₂H₄Cl₄O

InChI: InChI=1/C12H4Cl4O/c13-5-2-1-3-8-9(5)10-6(14)4-7(15)11(16)12(10)17-8/h1-4H

SMILES: c1cc(c2c(c1)oc1c2c(cc(c1Cl)Cl)Cl)Cl

Synonyms:

• 1,3,4,9-Tetrachlorodibenzofuran
• Dibenzofuran, 1,3,4,9-tetrachloro