CAS 83704-31-8

2,3,4,7-tetrachlorodibenzo[b,d]furan

Description:

2,3,4,7-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound that belongs to the class of polychlorinated dibenzofurans (PCDFs), which are known for their environmental persistence and potential toxicity. This compound features a dibenzofuran structure with four chlorine atoms substituted at specific positions on the aromatic rings, contributing to its chemical stability and lipophilicity. It is typically a white to light yellow solid and is insoluble in water but soluble in organic solvents. Due to its chlorinated nature, it can exhibit significant bioaccumulation in living organisms, raising concerns regarding its environmental impact and potential health effects, including carcinogenicity and endocrine disruption. The compound is often studied in the context of environmental chemistry, toxicology, and regulatory assessments, particularly regarding its presence in industrial waste and its implications for human health and ecosystems. Proper handling and disposal are crucial due to its hazardous nature.

Formula: C₁₂H₄Cl₄O

InChI: InChI=1/C12H4Cl4O/c13-5-1-2-6-7-4-8(14)10(15)11(16)12(7)17-9(6)3-5/h1-4H

SMILES: c1cc2c3cc(c(c(c3oc2cc1Cl)Cl)Cl)Cl

Synonyms:

• 2,3,4,7-Tetrachlorodibenzofuran
• Dibenzofuran, 2,3,4,7-tetrachloro