CAS 83704-32-9
:2,3,4,8-tetrachlorodibenzo[b,d]furan
Description:
2,3,4,8-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound belonging to the class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. This compound features a dibenzofuran structure with four chlorine atoms substituted at specific positions, contributing to its chemical stability and lipophilicity. It is typically a white to light yellow solid and is insoluble in water but soluble in organic solvents. Due to its chlorinated nature, it may exhibit bioaccumulation in living organisms and has been studied for its potential effects on human health and the environment. The compound is of interest in environmental chemistry, particularly concerning its formation as a byproduct in various industrial processes, including waste incineration. Its persistence in the environment raises concerns regarding its ecological impact and potential as a pollutant. Regulatory assessments often focus on its toxicity, carcinogenic potential, and the need for monitoring in environmental samples.
Formula:C12H4Cl4O
InChI:InChI=1/C12H4Cl4O/c13-5-1-2-9-6(3-5)7-4-8(14)10(15)11(16)12(7)17-9/h1-4H
SMILES:c1cc2c(cc1Cl)c1cc(c(c(c1o2)Cl)Cl)Cl
Synonyms:- 2,3,4,8-Tetrachlorodibenzofuran
- Dibenzofuran, 2,3,4,8-tetrachloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.