CAS 83704-41-0
:1,4,7-trichlorodibenzo[b,d]furan
Description:
1,4,7-Trichlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with three chlorine substituents at the 1, 4, and 7 positions. This compound is typically a solid at room temperature and is known for its stability and resistance to degradation. It exhibits hydrophobic properties, making it poorly soluble in water but more soluble in organic solvents. The presence of chlorine atoms enhances its potential for bioaccumulation and environmental persistence, raising concerns regarding its toxicity and ecological impact. 1,4,7-Trichlorodibenzo[b,d]furan is often studied in the context of environmental chemistry and toxicology, particularly regarding its formation as a byproduct in various industrial processes. Its chemical behavior can be influenced by the presence of other environmental factors, and it may undergo various reactions, including photodegradation and metabolic transformation in biological systems. Overall, this compound serves as an important subject of research due to its potential implications for human health and the environment.
Formula:C12H5Cl3O
InChI:InChI=1/C12H5Cl3O/c13-6-1-2-7-10(5-6)16-12-9(15)4-3-8(14)11(7)12/h1-5H
SMILES:c1cc2c(cc1Cl)oc1c(ccc(c21)Cl)Cl
Synonyms:- 1,4,7-Trichlorodibenzofuran
- Dibenzofuran, 1,4,7-trichloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.