CAS 83704-42-1
:2,4,7-trichlorodibenzo[b,d]furan
Description:
2,4,7-Trichlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with three chlorine substituents at the 2, 4, and 7 positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. It typically appears as a solid at room temperature and is insoluble in water, but may dissolve in organic solvents. The presence of chlorine atoms enhances its stability and lipophilicity, contributing to its bioaccumulation in living organisms. 2,4,7-Trichlorodibenzo[b,d]furan is of interest in environmental chemistry due to its potential as a pollutant and its implications for human health and ecosystems. Its synthesis and degradation pathways, as well as its interactions with biological systems, are subjects of ongoing research, particularly concerning its role in environmental contamination and toxicological effects.
Formula:C12H5Cl3O
InChI:InChI=1/C12H5Cl3O/c13-6-1-2-8-9-3-7(14)4-10(15)12(9)16-11(8)5-6/h1-5H
SMILES:c1cc2c3cc(cc(c3oc2cc1Cl)Cl)Cl
Synonyms:- 2,4,7-Trichlorodibenzofuran
- Dibenzofuran, 2,4,7-trichloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.