CymitQuimica logo

CAS 83704-48-7

:

1,2,3,4,7-pentachlorodibenzo[b,d]furan

Description:
1,2,3,4,7-Pentachlorodibenzo[b,d]furan is a synthetic organic compound belonging to the class of polychlorinated dibenzofurans (PCDFs), which are known for their environmental persistence and potential toxicity. This compound features a complex structure characterized by two fused benzene rings and a furan ring, with five chlorine atoms substituted at specific positions on the aromatic system. Its molecular structure contributes to its stability and resistance to degradation, making it a concern in environmental chemistry. 1,2,3,4,7-Pentachlorodibenzo[b,d]furan is often studied for its potential health effects, as many PCDFs are known to exhibit dioxin-like toxicity, which can lead to various adverse biological effects, including endocrine disruption and carcinogenicity. Due to its persistence in the environment, it can accumulate in the food chain, raising concerns about exposure to humans and wildlife. Regulatory measures often focus on monitoring and controlling the release of such compounds to mitigate their impact on health and the environment.
Formula:C12H3Cl5O
InChI:InChI=1/C12H3Cl5O/c13-4-1-2-5-6(3-4)18-12-7(5)8(14)9(15)10(16)11(12)17/h1-3H
SMILES:c1cc2c(cc1Cl)oc1c2c(c(c(c1Cl)Cl)Cl)Cl
Synonyms:
  • 1,2,3,4,7-Pentachlorodibenzofuran
  • Dibenzofuran, 1,2,3,4,7-pentachloro
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.