CAS 83704-50-1

1,2,4,6,7-pentachlorodibenzo[b,d]furan

Description:

1,2,4,6,7-Pentachlorodibenzo[b,d]furan is a synthetic organic compound belonging to the class of polychlorinated dibenzofurans (PCDFs), which are known for their environmental persistence and potential toxicity. This compound features a complex structure characterized by two fused benzene rings and a furan ring, with five chlorine atoms substituted at specific positions on the aromatic system. Its molecular structure contributes to its stability and resistance to degradation, making it a concern in environmental chemistry. 1,2,4,6,7-Pentachlorodibenzo[b,d]furan is typically formed as a byproduct in various industrial processes, particularly in the production of chlorinated compounds. It is classified as a persistent organic pollutant (POP) due to its bioaccumulation potential and associated health risks, including carcinogenicity and endocrine disruption. Regulatory agencies monitor its presence in the environment, particularly in soil and aquatic systems, as well as in food chains, due to its harmful effects on wildlife and human health.

Formula: C₁₂H₃Cl₅O

InChI: InChI=1/C12H3Cl5O/c13-5-2-1-4-8-9(16)6(14)3-7(15)12(8)18-11(4)10(5)17/h1-3H

SMILES: c1cc(c(c2c1c1c(c(cc(c1o2)Cl)Cl)Cl)Cl)Cl

Synonyms:

• 1,2,4,6,7-Pentachlorodibenzofuran
• Dibenzofuran, 1,2,4,6,7-pentachloro