CAS 83704-53-4
:1,2,3,7,9-Pentachlorodibenzofuran
Description:
1,2,3,7,9-Pentachlorodibenzofuran (CAS 83704-53-4) is a chlorinated aromatic compound belonging to the dibenzofuran family. It is characterized by the presence of five chlorine atoms substituted at specific positions on the dibenzofuran structure, which consists of two fused benzene rings connected by a furan ring. This compound is typically a white to light yellow solid and is known for its persistence in the environment, as well as its potential for bioaccumulation in living organisms. Its chemical stability and lipophilicity contribute to its long-term presence in ecosystems. 1,2,3,7,9-Pentachlorodibenzofuran is of interest due to its toxicological properties, which may include endocrine disruption and other adverse health effects in humans and wildlife. As a member of the polychlorinated dibenzofuran (PCDF) group, it is often studied in the context of environmental pollution and regulatory assessments related to hazardous substances. Proper handling and disposal are essential due to its potential environmental and health risks.
Formula:C12H3Cl5O
InChI:InChI=1S/C12H3Cl5O/c13-4-1-5(14)9-7(2-4)18-8-3-6(15)11(16)12(17)10(8)9/h1-3H
InChI key:InChIKey=JVUSEQPOWCBYNG-UHFFFAOYSA-N
SMILES:ClC1=C2C=3C(OC2=CC(Cl)=C1Cl)=CC(Cl)=CC3Cl
Synonyms:- 1,2,3,7,9-PeCDF
- 1,2,3,7,9-Pentachlorodibenzofuran
- Dibenzofuran, 1,2,3,7,9-pentachloro
- Pcdf 95
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.