CymitQuimica logo

CAS 83725-18-2

:

1-(2-Ethenylphenyl)pyrrolidine

Description:
1-(2-Ethenylphenyl)pyrrolidine, with the CAS number 83725-18-2, is an organic compound characterized by its unique structure, which includes a pyrrolidine ring and a vinyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the vinyl group suggests that it may participate in various addition reactions, making it a candidate for further chemical transformations. Additionally, the pyrrolidine moiety can influence the compound's basicity and steric properties, which may affect its interactions in biological systems or synthetic applications. The compound's solubility is likely influenced by the balance between its hydrophobic aromatic region and the more polar pyrrolidine ring. Overall, 1-(2-Ethenylphenyl)pyrrolidine is of interest in organic synthesis and may have applications in pharmaceuticals or materials science due to its structural features and potential reactivity.
Formula:C12H15N
InChI:InChI=1S/C12H15N/c1-2-11-7-3-4-8-12(11)13-9-5-6-10-13/h2-4,7-8H,1,5-6,9-10H2
InChI key:InChIKey=YJKOOXFXVMNVGC-UHFFFAOYSA-N
SMILES:C(=C)C1=C(C=CC=C1)N2CCCC2
Synonyms:
  • 1-(2-Ethenylphenyl)pyrrolidine
  • Pyrrolidine, 1-(2-ethenylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.