CAS 83725-24-0
:28-O-β-D-Glucopyranosyl pomolic acid
Description:
28-O-β-D-Glucopyranosyl pomolic acid is a glycosylated triterpenoid compound derived from pomolic acid, which is known for its potential biological activities. The structure features a glucopyranosyl group attached at the 28th position of the pomolic acid backbone, enhancing its solubility and bioavailability. This compound is typically characterized by its molecular weight, specific functional groups, and stereochemistry, which contribute to its reactivity and interaction with biological systems. It may exhibit various pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities, making it of interest in medicinal chemistry and natural product research. The presence of the glucopyranosyl moiety can also influence its pharmacokinetics and mechanism of action. As with many natural products, the extraction and purification processes are crucial for obtaining this compound in a form suitable for further study. Overall, 28-O-β-D-Glucopyranosyl pomolic acid represents a significant area of interest for researchers exploring the therapeutic potential of plant-derived compounds.
Formula:C36H58O9
InChI:InChI=1S/C36H58O9/c1-19-10-15-36(30(42)45-29-27(41)26(40)25(39)21(18-37)44-29)17-16-33(5)20(28(36)35(19,7)43)8-9-23-32(4)13-12-24(38)31(2,3)22(32)11-14-34(23,33)6/h8,19,21-29,37-41,43H,9-18H2,1-7H3/t19-,21-,22+,23-,24+,25-,26+,27-,28-,29+,32+,33-,34-,35-,36+/m1/s1
InChI key:InChIKey=RRIMLWHUVCZACL-HPUCWRFUSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O)CC6)[H])[H])([C@](C)(O)[C@H](C)CC3)[H]
Synonyms:- Pomolic acid β-D-glucopyranosyl ester
- Pomolic acid, 28-O-β-D-Glucopyranosyl ester
- 28-O-β-D-Glucopyranosyl pomolic acid
- Urs-12-en-28-oic acid, 3,19-dihydroxy-, β-D-glucopyranosyl ester, (3β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
28-O-β-D-Glucopyranosyl pomolic acid
CAS:<p>Pomolic acid 28-O-beta-D-glucopyranosyl ester is a natural product</p>Formula:C36H58O9Purity:98%Color and Shape:SolidMolecular weight:634.84Pomolic acid 28-O-b-D-glucopyranosyl ester
CAS:<p>Pomolic acid is a saponin isolated from the ethanol extract of Astragalus membranaceus. Pomolic acid has a nitrite reductase inhibitory effect and inhibits cell proliferation in certain cells, such as those found in the pancreas. The chemical structure of pomolic acid and its derivatives are similar to those of steroid glycosides and steroid alkaloids. It also has the ability to disrupt DNA replication and reduce insulin resistance. The use of pomolic acid in Chinese medicine formulas is reported to be effective for treating diabetes mellitus type 2, hyperlipidemia, and obesity.</p>Purity:Min. 95%



