
CAS 83728-67-0
:Methyl 4-(4-morpholinyl)-2-pyridinecarboxylate
Description:
Methyl 4-(4-morpholinyl)-2-pyridinecarboxylate, with the CAS number 83728-67-0, is a chemical compound characterized by its pyridine and morpholine functional groups. It typically appears as a white to off-white solid or crystalline powder. The presence of the morpholine ring contributes to its potential as a pharmacophore, often enhancing solubility and biological activity. This compound is known for its role in medicinal chemistry, particularly in the development of various pharmaceuticals. It exhibits properties such as moderate polarity due to the carboxylate ester and the nitrogen-containing heterocycles, which can influence its interaction with biological targets. Additionally, it may possess moderate to high stability under standard laboratory conditions, although specific stability can depend on environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Methyl 4-(4-morpholinyl)-2-pyridinecarboxylate is of interest in research and development within the fields of organic and medicinal chemistry.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c1-15-11(14)10-8-9(2-3-12-10)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=GCQFDBHRYFQDMQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CC=N1)N2CCOCC2
Synonyms:- 2-Pyridinecarboxylic acid, 4-(4-morpholinyl)-, methyl ester
- Methyl 4-(4-morpholinyl)-2-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.