CAS 837376-48-4
:5-(3-Pyridinyl)-2-furanmethanamine
Description:
5-(3-Pyridinyl)-2-furanmethanamine, with the CAS number 837376-48-4, is an organic compound characterized by its unique structure that combines a pyridine ring and a furan moiety. This compound typically exhibits properties associated with both heterocyclic systems, such as potential aromaticity and reactivity due to the presence of nitrogen and oxygen atoms in its rings. It is likely to be a solid at room temperature and may have moderate solubility in polar solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and reactivity can be influenced by the electronic properties of the pyridine and furan rings, as well as the amine group. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity with other chemicals.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c11-6-9-3-4-10(13-9)8-2-1-5-12-7-8/h1-5,7H,6,11H2
InChI key:InChIKey=LENAVORGWBTPJR-UHFFFAOYSA-N
SMILES:C(N)C=1OC(=CC1)C=2C=CC=NC2
Synonyms:- 5-(3-Pyridinyl)-2-furanmethanamine
- [5-(Pyridin-3-yl)furan-2-yl]methanamine
- 2-Furanmethanamine, 5-(3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.