CAS 837392-64-0: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydro-2H-indol-2-one
Description:5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydro-2H-indol-2-one is a chemical compound characterized by its unique structure, which includes an indole moiety and a boron-containing dioxaborolane group. The presence of the dioxaborolane unit suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The indole structure contributes to its potential biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. This compound may exhibit properties such as fluorescence or reactivity with nucleophiles due to the boron atom's electrophilic nature. Additionally, the bulky tetramethyl groups enhance its stability and solubility in organic solvents. Overall, this compound's unique features make it a subject of interest in both synthetic and medicinal chemistry, with potential applications in drug development and material science.
Formula:C14H18BNO3
InChI:InChI=1S/C14H18BNO3/c1-13(2)14(3,4)19-15(18-13)10-5-6-11-9(7-10)8-12(17)16-11/h5-7H,8H2,1-4H3,(H,16,17)
InChI key:InChIKey=BXFPTCYBFJOZHJ-UHFFFAOYSA-N
SMILES:O=C1NC2=CC=C(C=C2C1)B3OC(C)(C)C(O3)(C)C
- Synonyms:
- 1,3-Dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indol-2-one
- 1,3-Dihydroindol-2-one-5-boronicacidpinacolester
- 2-(Oxindole-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 2H-indol-2-one, 1,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)indolin-2-one
