CAS 837421-28-0

1-(2-Fluoro-4-nitrophenyl)-3-methylpiperazine

Description:

1-(2-Fluoro-4-nitrophenyl)-3-methylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2-fluoro-4-nitrophenyl group indicates that the compound has both a fluorine atom and a nitro group attached to a phenyl ring, contributing to its unique chemical properties. This substitution pattern can influence the compound's reactivity, solubility, and biological activity. The piperazine moiety is known for its role in various pharmacological applications, often serving as a scaffold in drug design. The compound may exhibit interesting interactions with biological targets due to the electron-withdrawing effects of the nitro group and the electronegative fluorine atom, potentially affecting its lipophilicity and overall pharmacokinetics. As with many compounds containing nitro and halogen substituents, it may also be subject to specific safety and handling considerations due to potential toxicity. Overall, this compound's structural features suggest it could be of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₄FN₃O₂

InChI: InChI=1S/C11H14FN3O2/c1-8-7-14(5-4-13-8)11-3-2-9(15(16)17)6-10(11)12/h2-3,6,8,13H,4-5,7H2,1H3

InChI key: InChIKey=CPSPDIOZYSRWAZ-UHFFFAOYSA-N

SMILES: FC1=C(N2CC(C)NCC2)C=CC(N(=O)=O)=C1

Synonyms:

• Piperazine, 1-(2-fluoro-4-nitrophenyl)-3-methyl-
• 1-(2-Fluoro-4-nitrophenyl)-3-methylpiperazine
• 4-(2-Fluoro-4-nitrophenyl)-2-methylpiperazine