CAS 837428-13-4

6-ethoxynaphthalen-1-amine

Description:

6-Ethoxynaphthalen-1-amine is an organic compound characterized by its naphthalene backbone substituted with an ethoxy group and an amino group. The presence of the ethoxy group at the 6-position and the amino group at the 1-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the hydrophobic nature of the naphthalene structure, while the amino group can engage in hydrogen bonding, enhancing solubility in polar solvents. It may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions, owing to the reactivity of the amino group. Additionally, 6-ethoxynaphthalen-1-amine may have applications in organic synthesis, pharmaceuticals, or as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₃NO

InChI: InChI=1/C12H13NO/c1-2-14-10-6-7-11-9(8-10)4-3-5-12(11)13/h3-8H,2,13H2,1H3

Synonyms:

• 6-Ethoxy-1-naphthalenamine