CAS 837430-15-6
:2,2,2-Trifluoroacetic acid 2-(2-pyrazinyl)hydrazide
Description:
2,2,2-Trifluoroacetic acid 2-(2-pyrazinyl)hydrazide is a chemical compound characterized by its unique structural features, which include a trifluoroacetic acid moiety and a pyrazinyl hydrazide group. This compound typically exhibits properties associated with both hydrazides and fluorinated carboxylic acids, such as increased acidity due to the presence of the trifluoroacetyl group. The trifluoromethyl groups enhance the compound's lipophilicity and may influence its reactivity and biological activity. The pyrazinyl ring contributes to the compound's potential for forming hydrogen bonds and participating in various chemical interactions. In terms of applications, compounds like this may be explored in medicinal chemistry for their potential pharmacological properties, including antimicrobial or anti-inflammatory activities. Additionally, the presence of fluorine atoms often imparts unique characteristics, such as increased metabolic stability and altered solubility profiles. Overall, 2,2,2-Trifluoroacetic acid 2-(2-pyrazinyl)hydrazide represents a class of compounds that can be of interest in both synthetic and pharmaceutical chemistry.
Formula:C6H5F3N4O
InChI:InChI=1S/C6H5F3N4O/c7-6(8,9)5(14)13-12-4-3-10-1-2-11-4/h1-3H,(H,11,12)(H,13,14)
InChI key:InChIKey=LXAMIEHRHJSCKX-UHFFFAOYSA-N
SMILES:N(NC(C(F)(F)F)=O)C=1C=NC=CN1
Synonyms:- Acetic acid, trifluoro-, 2-pyrazinylhydrazide
- 2,2,2-Trifluoroacetic acid 2-(2-pyrazinyl)hydrazide
- Acetic acid, 2,2,2-trifluoro-, 2-(2-pyrazinyl)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(Pyrazin-2-yl)-2-trifluoroacetyl Hydrazine
CAS:Controlled ProductFormula:C6H5F3N4OColor and Shape:NeatMolecular weight:206.125

