CAS 83763-09-1

Methyl 2,3-dihydro-3-phenyl-2-thioxo-1H-imidazole-4-carboxylate

Description:

Methyl 2,3-dihydro-3-phenyl-2-thioxo-1H-imidazole-4-carboxylate, with the CAS number 83763-09-1, is a chemical compound that belongs to the class of imidazole derivatives. This compound features a thioxo group, which contributes to its unique reactivity and potential biological activity. It typically exhibits a molecular structure characterized by a five-membered imidazole ring, which is fused with a phenyl group and contains a carboxylate ester functionality. The presence of the thioxo group may enhance its properties as a potential pharmacophore, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents, and its reactivity can be influenced by the substituents on the imidazole ring. As with many imidazole derivatives, it may exhibit various biological activities, including antimicrobial or antifungal properties, although specific biological data would need to be referenced for detailed applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₀N₂O₂S

InChI: InChI=1S/C11H10N2O2S/c1-15-10(14)9-7-12-11(16)13(9)8-5-3-2-4-6-8/h2-7H,1H3,(H,12,16)

InChI key: InChIKey=LBAHSLRQMFWHLF-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N(C(=S)NC1)C2=CC=CC=C2

Synonyms:

• NSC 97021
• Methyl 2,3-dihydro-3-phenyl-2-thioxo-1H-imidazole-4-carboxylate
• 1H-Imidazole-4-carboxylic acid, 2,3-dihydro-3-phenyl-2-thioxo-, methyl ester