
CAS 83763-35-3
:Benzenesulfonamide, 3-amino-4-hydroxy-N,N-dimethyl-, hydrochloride (1:1)
Description:
Benzenesulfonamide, 3-amino-4-hydroxy-N,N-dimethyl-, hydrochloride (1:1), with the CAS number 83763-35-3, is a chemical compound characterized by its sulfonamide structure, which includes a benzene ring substituted with an amino group and a hydroxy group, along with two methyl groups attached to the nitrogen atom. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. It exhibits properties associated with both sulfonamides and amines, making it relevant in various chemical and pharmaceutical applications. The presence of the amino and hydroxy groups contributes to its potential biological activity, which may include antimicrobial properties. Additionally, the compound's hydrochloride form enhances its stability and solubility, facilitating its use in formulations. As with many sulfonamides, it may also be subject to regulatory considerations due to its biological activity and potential effects on human health and the environment.
Formula:C8H12N2O3S·ClH
InChI:InChI=1S/C8H12N2O3S.ClH/c1-10(2)14(12,13)6-3-4-8(11)7(9)5-6;/h3-5,11H,9H2,1-2H3;1H
InChI key:InChIKey=VFCMSRKNRBRJGK-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=CC(N)=C(O)C=C1.Cl
Synonyms:- Benzenesulfonamide, 3-amino-4-hydroxy-N,N-dimethyl-, hydrochloride (1:1)
- Benzenesulfonamide, 3-amino-4-hydroxy-N,N-dimethyl-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.