
CAS 83774-20-3
:3-(1-Methylethoxy)-6-(1-piperazinyl)pyridazine
Description:
3-(1-Methylethoxy)-6-(1-piperazinyl)pyridazine, with the CAS number 83774-20-3, is a chemical compound that belongs to the class of pyridazines, which are five-membered heterocyclic compounds containing two nitrogen atoms. This substance features a pyridazine ring substituted with a 1-methylethoxy group and a piperazine moiety, which contributes to its potential biological activity. The presence of the piperazine ring often indicates possible interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic and hydrophilic regions, influenced by the alkoxy and piperazine substituents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, given the piperazine's common use in such contexts. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C11H18N4O
InChI:InChI=1S/C11H18N4O/c1-9(2)16-11-4-3-10(13-14-11)15-7-5-12-6-8-15/h3-4,9,12H,5-8H2,1-2H3
InChI key:InChIKey=AASHGNFDBLMTQN-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=CC=C(N=N1)N2CCNCC2
Synonyms:- 3-(1-Methylethoxy)-6-(1-piperazinyl)pyridazine
- Pyridazine, 3-(1-methylethoxy)-6-(1-piperazinyl)-
- 3-Isopropoxy-6-(piperazin-1-yl)pyridazine
- 3-Isopropoxy-6-piperazin-1-ylpyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.