CAS 83783-34-0

3-Acetyl-1H-indole-6-carbonitrile

Description:

3-Acetyl-1H-indole-6-carbonitrile is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features an acetyl group at the 3-position and a cyano group at the 6-position of the indole ring. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The presence of both the acetyl and cyano functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different chemical environments. As with many indole derivatives, it may serve as a precursor for the synthesis of more complex molecules or as a building block in the development of new drugs.

Formula: C₁₁H₈N₂O

InChI: InChI=1S/C11H8N2O/c1-7(14)10-6-13-11-4-8(5-12)2-3-9(10)11/h2-4,6,13H,1H3

InChI key: InChIKey=GRGVUXDVCKDSCC-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=2C(=CC(C#N)=CC2)NC1

Synonyms:

• 3-Acetyl-1H-indole-6-carbonitrile
• 1H-Indole-6-carbonitrile, 3-acetyl-