CAS 83783-49-7

1-(2,4-Dichlorophenyl)cyclopropanecarbonyl chloride

Description:

1-(2,4-Dichlorophenyl)cyclopropanecarbonyl chloride, with the CAS number 83783-49-7, is a chemical compound characterized by its cyclopropane structure substituted with a carbonyl chloride group and a dichlorophenyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity due to the presence of the carbonyl chloride functional group, which can participate in nucleophilic substitution reactions. The dichlorophenyl group contributes to its potential biological activity and may influence its solubility and stability in various solvents. This compound is often utilized in organic synthesis, particularly in the preparation of other chemical entities, including pharmaceuticals and agrochemicals. Safety precautions are essential when handling this substance, as it may be corrosive and harmful upon exposure. Proper storage conditions should be maintained to prevent degradation and ensure stability.

Formula: C₁₀H₇Cl₃O

InChI: InChI=1S/C10H7Cl3O/c11-6-1-2-7(8(12)5-6)10(3-4-10)9(13)14/h1-2,5H,3-4H2

InChI key: InChIKey=SSCVXWJUAAXOLL-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1(CC1)C2=C(Cl)C=C(Cl)C=C2

Synonyms:

• 1-(2,4-Dichlorophenyl)cyclopropane-1-carbonyl chloride
• 1-(2,4-Dichlorophenyl)cyclopropanecarbonyl chloride
• Cyclopropanecarbonyl chloride, 1-(2,4-dichlorophenyl)-