CAS 83783-71-5

3-[[1-(Phenylmethyl)-4-piperidinyl]amino]propanenitrile

Description:

3-[[1-(Phenylmethyl)-4-piperidinyl]amino]propanenitrile, with the CAS number 83783-71-5, is a chemical compound characterized by its piperidine and nitrile functional groups. This substance typically exhibits properties associated with its structural components, including potential basicity due to the piperidine ring, which can engage in hydrogen bonding and interact with biological targets. The presence of the phenylmethyl group may enhance lipophilicity, influencing its solubility and permeability in biological systems. As a nitrile, it may also participate in various chemical reactions, such as nucleophilic additions or hydrolysis. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, which may include effects on the central nervous system. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and form of the compound. Safety and handling considerations are essential, as with many organic compounds, to mitigate any potential hazards associated with exposure.

Formula: C₁₅H₂₁N₃

InChI: InChI=1S/C15H21N3/c16-9-4-10-17-15-7-11-18(12-8-15)13-14-5-2-1-3-6-14/h1-3,5-6,15,17H,4,7-8,10-13H2

InChI key: InChIKey=VVCSAMZZQCPYFB-UHFFFAOYSA-N

SMILES: C(N1CCC(NCCC#N)CC1)C2=CC=CC=C2

Synonyms:

• 3-[(1-Benzylpiperidin-4-yl)amino]propanenitrile
• 3-[[1-(Phenylmethyl)-4-piperidinyl]amino]propanenitrile
• Propanenitrile, 3-[[1-(phenylmethyl)-4-piperidinyl]amino]-