
CAS 83783-82-8
:3-Methyl-2-buten-1-yl (2Z)-2-methyl-2-butenoate
Description:
3-Methyl-2-buten-1-yl (2Z)-2-methyl-2-butenoate, with the CAS number 83783-82-8, is an organic compound that belongs to the class of esters. It is characterized by its structure, which includes a methyl group and a butenoate moiety, contributing to its reactivity and potential applications in organic synthesis. This compound typically exhibits a pleasant, fruity odor, making it of interest in the flavor and fragrance industry. It is a colorless to pale yellow liquid at room temperature and is generally soluble in organic solvents. The presence of double bonds in its structure indicates that it may participate in various chemical reactions, such as addition reactions, which can be exploited in synthetic chemistry. Additionally, its unique configuration may influence its biological activity, making it a candidate for further research in fields such as medicinal chemistry or agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c1-5-9(4)10(11)12-7-6-8(2)3/h5-6H,7H2,1-4H3/b9-5-
InChI key:InChIKey=WTDWXMWAIMIKSI-UITAMQMPSA-N
SMILES:C(OCC=C(C)C)(/C(=C\C)/C)=O
Synonyms:- 3-Methyl-2-buten-1-yl (2Z)-2-methyl-2-butenoate
- 2-Butenoic acid, 2-methyl-, 3-methyl-2-buten-1-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 3-methyl-2-butenyl ester, (Z)-
- 3-Methyl-2-butenyl angelate
- 2-Butenoic acid, 2-methyl-, 3-methyl-2-butenyl ester, (2Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Methylbut-2-en-1-yl (2Z)-2-methylbut-2-enoate
CAS:3-Methylbut-2-en-1-yl (2Z)-2-methylbut-2-enoate is an acidic surfactant that is a peroxide. It is used as a chemical intermediate in the manufacture of other chemicals, such as perfume and cleaning agents. The chemical has a ring structure with two aldehyde groups and one mercapto group. This molecule's hydrocarbon group contains a hydrogen atom that can be oxidized to form an acid. 3-Methylbut-2-en-1-yl (2Z)-2-methylbut-2-enoate has been shown to have deodorizing properties by reacting with odorants to form odorless compounds.Formula:C10H16O2Purity:Min. 95%Molecular weight:168.23 g/mol
