
CAS 83789-92-8
:4,4′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyloxy)]bis[benzenamine]
Description:
4,4′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyloxy)]bis[benzenamine], also known by its CAS number 83789-92-8, is an organic compound characterized by its complex structure featuring two benzenamine groups linked by a bis(ethanediyloxy) moiety. This compound typically exhibits properties associated with both amines and ether functionalities, which can influence its solubility, reactivity, and potential applications. The presence of the ether linkages suggests that it may have good thermal stability and resistance to hydrolysis, while the amine groups can participate in hydrogen bonding and may exhibit basicity. Such compounds are often explored in materials science, particularly in the development of polymers or as intermediates in organic synthesis. Additionally, the molecular structure may impart specific electronic properties, making it of interest in fields such as organic electronics or dye chemistry. Overall, the unique combination of functional groups in this compound contributes to its versatility in various chemical applications.
Formula:C20H28N2O5
InChI:InChI=1S/C20H28N2O5/c21-17-1-5-19(6-2-17)26-15-13-24-11-9-23-10-12-25-14-16-27-20-7-3-18(22)4-8-20/h1-8H,9-16,21-22H2
InChI key:InChIKey=XBBXNWDBFRCRPY-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOC1=CC=C(N)C=C1)C2=CC=C(N)C=C2
Synonyms:- Benzenamine, 4,4′-[oxybis(2,1-ethanediyloxy-2,1-ethanediyloxy)]bis-
- 4,4′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyloxy)]bis[benzenamine]
- Tetraethylene glycol bis(4-aminophenyl) ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenamine, 4,4′-[oxybis(2,1-ethanediyloxy-2,1-ethanediyloxy)]bis-
CAS:Formula:C20H28N2O5Molecular weight:376.4467
