CAS 83792-48-7
:fmoc-O-benzyl-L-serine
Description:
Fmoc-O-benzyl-L-serine is a derivative of the amino acid serine, characterized by the presence of a fluorenylmethyloxycarbonyl (Fmoc) protecting group and a benzyl group attached to the hydroxyl side chain of serine. This compound is commonly used in peptide synthesis, particularly in solid-phase peptide synthesis, due to the stability of the Fmoc group under basic conditions and its ease of removal under mild acidic conditions. The benzyl group enhances the hydrophobic character of the molecule, which can influence the solubility and reactivity during synthesis. Fmoc-O-benzyl-L-serine is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its structure allows for the selective protection of the serine hydroxyl group while maintaining the amino group free for coupling reactions. Overall, this compound is valuable in the field of peptide chemistry for the synthesis of complex peptides and proteins.
Formula:C25H23NO5
InChI:InChI=1/C25H23NO5/c27-24(28)23(16-30-14-17-8-2-1-3-9-17)26-25(29)31-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,26,29)(H,27,28)/t23-/m0/s1
SMILES:c1ccc(cc1)COC[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-Ser(Bzl)-OH
- O-benzyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine
- N-Fmoc-O-benzyl-L-serine
- Fmoc-N-Me-L-Val
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fmoc-Ser(Bzl)-OH
CAS:Bachem ID: 4004135.
Formula:C25H23NO5Purity:99.5%Color and Shape:WhiteMolecular weight:417.46Fmoc-Ser(Bzl)-OH
CAS:Formula:C25H23NO5Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:417.46Fmoc-O-benzyl-L-serine
CAS:Fmoc-O-benzyl-L-serine is a synthetic amino acid that is synthesized by the reaction of piperidine and L-serine. This amino acid has high specificity and is used in the synthesis of human cell lines. Fmoc-O-benzyl-L-serine may be useful for bone morphogenetic protein (BMP) activation, cancer treatment, and other therapeutic purposes. It also integrates with a linker to form peptides or proteins, which can be optimized for specific uses. The synthesis methods of this amino acid are proteolytic, solid phase synthesis, and optimization.
Formula:C25H23NO5Purity:(%) Min. 99%Color and Shape:White PowderMolecular weight:417.45 g/molFmoc-Ser(Bzl)-OH
CAS:M03383 - Fmoc-Ser(Bzl)-OH
Formula:C25H23NO5Purity:98%Color and Shape:Beige powderMolecular weight:417.461FMOC-O-Benzyl-L-Serine extrapure, 98%
CAS:Formula:C25H23NO5Purity:min. 98%Color and Shape:White to Light Yellow, Powder to crystals, ClearMolecular weight:417.45







